C12H13Br3O3 — CID 100971541
[2-methoxy-4-(1,3,3-tribromopropyl)phenyl] acetate (PubChem CID 100971541) has the molecular formula C12H13Br3O3 and a molecular weight of 444.95 g/mol. Its IUPAC name is [2-methoxy-4-(1,3,3-tribromopropyl)phenyl] acetate.
| Compound Name | [2-methoxy-4-(1,3,3-tribromopropyl)phenyl] acetate |
|---|---|
| PubChem CID | 100971541 |
| Molecular Formula | C12H13Br3O3 |
| Molecular Weight | 444.95 g/mol |
| Exact Mass | 441.84 |
| IUPAC Name | [2-methoxy-4-(1,3,3-tribromopropyl)phenyl] acetate |
| SMILES | COc1cc(C(Br)CC(Br)Br)ccc1OC(C)=O |
| InChI | InChI=1S/C12H13Br3O3/c1-7(16)18-10-4-3-8(5-11(10)17-2)9(13)6-12(14)15/h3-5,9,12H,6H2,1-2H3 |
| InChIKey | UPWKWKSDHNJMBY-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.95 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|