C14H18FNO5 — CID 171243336
ethyl (3R)-3-(4-acetyloxy-3-methoxyphenyl)-3-amino-2-fluoropropanoate (PubChem CID 171243336) has the molecular formula C14H18FNO5 and a molecular weight of 299.30 g/mol. Its IUPAC name is ethyl (3R)-3-(4-acetyloxy-3-methoxyphenyl)-3-amino-2-fluoropropanoate.
| Compound Name | ethyl (3R)-3-(4-acetyloxy-3-methoxyphenyl)-3-amino-2-fluoropropanoate |
|---|---|
| PubChem CID | 171243336 |
| Molecular Formula | C14H18FNO5 |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | ethyl (3R)-3-(4-acetyloxy-3-methoxyphenyl)-3-amino-2-fluoropropanoate |
| SMILES | CCOC(=O)C(F)[C@H](N)c1ccc(OC(C)=O)c(OC)c1 |
| InChI | InChI=1S/C14H18FNO5/c1-4-20-14(18)12(15)13(16)9-5-6-10(21-8(2)17)11(7-9)19-3/h5-7,12-13H,4,16H2,1-3H3/t12?,13-/m1/s1 |
| InChIKey | IZMGZAKGKQKDMI-ZGTCLIOFSA-N |
| XLogP | 1.52 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|