C14H20FNO4 — CID 171250049
ethyl (3S)-3-amino-3-(3-ethoxy-4-methoxyphenyl)-2-fluoropropanoate (PubChem CID 171250049) has the molecular formula C14H20FNO4 and a molecular weight of 285.31 g/mol. Its IUPAC name is ethyl (3S)-3-amino-3-(3-ethoxy-4-methoxyphenyl)-2-fluoropropanoate.
| Compound Name | ethyl (3S)-3-amino-3-(3-ethoxy-4-methoxyphenyl)-2-fluoropropanoate |
|---|---|
| PubChem CID | 171250049 |
| Molecular Formula | C14H20FNO4 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | ethyl (3S)-3-amino-3-(3-ethoxy-4-methoxyphenyl)-2-fluoropropanoate |
| SMILES | CCOC(=O)C(F)[C@@H](N)c1ccc(OC)c(OCC)c1 |
| InChI | InChI=1S/C14H20FNO4/c1-4-19-11-8-9(6-7-10(11)18-3)13(16)12(15)14(17)20-5-2/h6-8,12-13H,4-5,16H2,1-3H3/t12?,13-/m0/s1 |
| InChIKey | WJJASLCBCTYLFV-ABLWVSNPSA-N |
| XLogP | 1.99 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |