C12H15ClFNO3 — CID 171251378
ethyl (3S)-3-amino-3-(5-chloro-2-methoxyphenyl)-2-fluoropropanoate (PubChem CID 171251378) has the molecular formula C12H15ClFNO3 and a molecular weight of 275.71 g/mol. Its IUPAC name is ethyl (3S)-3-amino-3-(5-chloro-2-methoxyphenyl)-2-fluoropropanoate.
| Compound Name | ethyl (3S)-3-amino-3-(5-chloro-2-methoxyphenyl)-2-fluoropropanoate |
|---|---|
| PubChem CID | 171251378 |
| Molecular Formula | C12H15ClFNO3 |
| Molecular Weight | 275.71 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | ethyl (3S)-3-amino-3-(5-chloro-2-methoxyphenyl)-2-fluoropropanoate |
| SMILES | CCOC(=O)C(F)[C@@H](N)c1cc(Cl)ccc1OC |
| InChI | InChI=1S/C12H15ClFNO3/c1-3-18-12(16)10(14)11(15)8-6-7(13)4-5-9(8)17-2/h4-6,10-11H,3,15H2,1-2H3/t10?,11-/m0/s1 |
| InChIKey | PJAOQCCQWOQGQL-DTIOYNMSSA-N |
| XLogP | 2.25 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.71 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |