C12H15BrFNO3 — CID 171240179
ethyl (3R)-3-amino-3-(5-bromo-2-methoxyphenyl)-2-fluoropropanoate (PubChem CID 171240179) has the molecular formula C12H15BrFNO3 and a molecular weight of 320.16 g/mol. Its IUPAC name is ethyl (3R)-3-amino-3-(5-bromo-2-methoxyphenyl)-2-fluoropropanoate.
| Compound Name | ethyl (3R)-3-amino-3-(5-bromo-2-methoxyphenyl)-2-fluoropropanoate |
|---|---|
| PubChem CID | 171240179 |
| Molecular Formula | C12H15BrFNO3 |
| Molecular Weight | 320.16 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | ethyl (3R)-3-amino-3-(5-bromo-2-methoxyphenyl)-2-fluoropropanoate |
| SMILES | CCOC(=O)C(F)[C@H](N)c1cc(Br)ccc1OC |
| InChI | InChI=1S/C12H15BrFNO3/c1-3-18-12(16)10(14)11(15)8-6-7(13)4-5-9(8)17-2/h4-6,10-11H,3,15H2,1-2H3/t10?,11-/m1/s1 |
| InChIKey | WETQFHDKQSGBNZ-RRKGBCIJSA-N |
| XLogP | 2.36 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.16 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |