C12H15BrFNO4 — CID 171243943
ethyl (3R)-3-amino-3-(5-bromo-2-hydroxy-3-methoxyphenyl)-2-fluoropropanoate (PubChem CID 171243943) has the molecular formula C12H15BrFNO4 and a molecular weight of 336.16 g/mol. Its IUPAC name is ethyl (3R)-3-amino-3-(5-bromo-2-hydroxy-3-methoxyphenyl)-2-fluoropropanoate.
| Compound Name | ethyl (3R)-3-amino-3-(5-bromo-2-hydroxy-3-methoxyphenyl)-2-fluoropropanoate |
|---|---|
| PubChem CID | 171243943 |
| Molecular Formula | C12H15BrFNO4 |
| Molecular Weight | 336.16 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | ethyl (3R)-3-amino-3-(5-bromo-2-hydroxy-3-methoxyphenyl)-2-fluoropropanoate |
| SMILES | CCOC(=O)C(F)[C@H](N)c1cc(Br)cc(OC)c1O |
| InChI | InChI=1S/C12H15BrFNO4/c1-3-19-12(17)9(14)10(15)7-4-6(13)5-8(18-2)11(7)16/h4-5,9-10,16H,3,15H2,1-2H3/t9?,10-/m1/s1 |
| InChIKey | LDKOJRMTDNGQTL-QVDQXJPCSA-N |
| XLogP | 2.06 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.16 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|