C12H16FNO4 — CID 171243721
ethyl (3R)-3-amino-2-fluoro-3-(2-hydroxy-3-methoxyphenyl)propanoate (PubChem CID 171243721) has the molecular formula C12H16FNO4 and a molecular weight of 257.26 g/mol. Its IUPAC name is ethyl (3R)-3-amino-2-fluoro-3-(2-hydroxy-3-methoxyphenyl)propanoate.
| Compound Name | ethyl (3R)-3-amino-2-fluoro-3-(2-hydroxy-3-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 171243721 |
| Molecular Formula | C12H16FNO4 |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | ethyl (3R)-3-amino-2-fluoro-3-(2-hydroxy-3-methoxyphenyl)propanoate |
| SMILES | CCOC(=O)C(F)[C@H](N)c1cccc(OC)c1O |
| InChI | InChI=1S/C12H16FNO4/c1-3-18-12(16)9(13)10(14)7-5-4-6-8(17-2)11(7)15/h4-6,9-10,15H,3,14H2,1-2H3/t9?,10-/m1/s1 |
| InChIKey | FXPKXMAJRCHXDW-QVDQXJPCSA-N |
| XLogP | 1.30 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|