About ethyl 2,3-dihydroxy-3-(2-hydroxy-3-methoxyphenyl)propanoate
ethyl 2,3-dihydroxy-3-(2-hydroxy-3-methoxyphenyl)propanoate (PubChem CID 171865973) has the molecular formula C12H16O6
and a molecular weight of 256.25 g/mol. Its IUPAC name is ethyl 2,3-dihydroxy-3-(2-hydroxy-3-methoxyphenyl)propanoate.
Analyze ethyl 2,3-dihydroxy-3-(2-hydroxy-3-methoxyphenyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2,3-dihydroxy-3-(2-hydroxy-3-methoxyphenyl)propanoate?
The IUPAC name of ethyl 2,3-dihydroxy-3-(2-hydroxy-3-methoxyphenyl)propanoate (CID 171865973) is ethyl 2,3-dihydroxy-3-(2-hydroxy-3-methoxyphenyl)propanoate.
What is the SMILES notation for ethyl 2,3-dihydroxy-3-(2-hydroxy-3-methoxyphenyl)propanoate?
The canonical SMILES for ethyl 2,3-dihydroxy-3-(2-hydroxy-3-methoxyphenyl)propanoate is CCOC(=O)C(O)C(O)c1cccc(OC)c1O.
What is the InChIKey of ethyl 2,3-dihydroxy-3-(2-hydroxy-3-methoxyphenyl)propanoate?
The InChIKey is RZQTVDOFEZMFAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O6/c1-3-18-12(16)11(15)10(14)7-5-4-6-8(17-2)9(7)13/h4-6,10-11,13-15H,3H2,1-2H3.
What are the key properties of ethyl 2,3-dihydroxy-3-(2-hydroxy-3-methoxyphenyl)propanoate?
ethyl 2,3-dihydroxy-3-(2-hydroxy-3-methoxyphenyl)propanoate has a molecular weight of 256.25 g/mol, XLogP of 0.36, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2,3-dihydroxy-3-(2-hydroxy-3-methoxyphenyl)propanoate is sourced from PubChem (CID 171865973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).