C11H15NO5 — CID 171865897
ethyl 2,3-dihydroxy-3-(4-methoxy-3-pyridinyl)propanoate (PubChem CID 171865897) has the molecular formula C11H15NO5 and a molecular weight of 241.24 g/mol. Its IUPAC name is ethyl 2,3-dihydroxy-3-(4-methoxy-3-pyridinyl)propanoate.
| Compound Name | ethyl 2,3-dihydroxy-3-(4-methoxy-3-pyridinyl)propanoate |
|---|---|
| PubChem CID | 171865897 |
| Molecular Formula | C11H15NO5 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | ethyl 2,3-dihydroxy-3-(4-methoxy-3-pyridinyl)propanoate |
| SMILES | CCOC(=O)C(O)C(O)c1cnccc1OC |
| InChI | InChI=1S/C11H15NO5/c1-3-17-11(15)10(14)9(13)7-6-12-5-4-8(7)16-2/h4-6,9-10,13-14H,3H2,1-2H3 |
| InChIKey | RYALYPTUNQSXHP-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 88.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |