ethyl 2,3-dihydroxy-3-isoquinolin-8-ylpropanoate

C14H15NO4 — CID 171866326

IUPACethyl 2,3-dihydroxy-3-isoquinolin-8-ylpropanoate
SMILESCCOC(=O)C(O)C(O)c1cccc2ccncc12
InChIInChI=1S/C14H15NO4/c1-2-19-14(18)13(17)12(16)10-5-3-4-9-6-7-15-8-11(9)10/h3-8,12-13,16-17H,2H2,1H3
InChIKeyLUFNACBDPYIWJX-UHFFFAOYSA-N
MW261.28 g/mol
LogP1.19
Rot. Bonds4

About ethyl 2,3-dihydroxy-3-isoquinolin-8-ylpropanoate

ethyl 2,3-dihydroxy-3-isoquinolin-8-ylpropanoate (PubChem CID 171866326) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is ethyl 2,3-dihydroxy-3-isoquinolin-8-ylpropanoate.

Molecular Properties

Compound Nameethyl 2,3-dihydroxy-3-isoquinolin-8-ylpropanoate
PubChem CID171866326
Molecular FormulaC14H15NO4
Molecular Weight261.28 g/mol
Exact Mass261.10
IUPAC Nameethyl 2,3-dihydroxy-3-isoquinolin-8-ylpropanoate
SMILESCCOC(=O)C(O)C(O)c1cccc2ccncc12
InChIInChI=1S/C14H15NO4/c1-2-19-14(18)13(17)12(16)10-5-3-4-9-6-7-15-8-11(9)10/h3-8,12-13,16-17H,2H2,1H3
InChIKeyLUFNACBDPYIWJX-UHFFFAOYSA-N
XLogP1.19
TPSA79.65 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500261.28
LogP ≤ 51.19
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze ethyl 2,3-dihydroxy-3-isoquinolin-8-ylpropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2,3-dihydroxy-3-isoquinolin-8-ylpropanoate?
The IUPAC name of ethyl 2,3-dihydroxy-3-isoquinolin-8-ylpropanoate (CID 171866326) is ethyl 2,3-dihydroxy-3-isoquinolin-8-ylpropanoate.
What is the SMILES notation for ethyl 2,3-dihydroxy-3-isoquinolin-8-ylpropanoate?
The canonical SMILES for ethyl 2,3-dihydroxy-3-isoquinolin-8-ylpropanoate is CCOC(=O)C(O)C(O)c1cccc2ccncc12.
What is the InChIKey of ethyl 2,3-dihydroxy-3-isoquinolin-8-ylpropanoate?
The InChIKey is LUFNACBDPYIWJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO4/c1-2-19-14(18)13(17)12(16)10-5-3-4-9-6-7-15-8-11(9)10/h3-8,12-13,16-17H,2H2,1H3.
What are the key properties of ethyl 2,3-dihydroxy-3-isoquinolin-8-ylpropanoate?
ethyl 2,3-dihydroxy-3-isoquinolin-8-ylpropanoate has a molecular weight of 261.28 g/mol, XLogP of 1.19, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2,3-dihydroxy-3-isoquinolin-8-ylpropanoate is sourced from PubChem (CID 171866326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).