About ethyl 2-methylpropanoate;isoquinoline
ethyl 2-methylpropanoate;isoquinoline (PubChem CID 158006464) has the molecular formula C15H19NO2
and a molecular weight of 245.32 g/mol. Its IUPAC name is ethyl 2-methylpropanoate;isoquinoline.
Molecular Properties
| Compound Name | ethyl 2-methylpropanoate;isoquinoline |
| PubChem CID | 158006464 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | ethyl 2-methylpropanoate;isoquinoline |
| SMILES | CCOC(=O)C(C)C.c1ccc2cnccc2c1 |
| InChI | InChI=1S/C9H7N.C6H12O2/c1-2-4-9-7-10-6-5-8(9)3-1;1-4-8-6(7)5(2)3/h1-7H;5H,4H2,1-3H3 |
| InChIKey | FEISXLBOQOGLLF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 2-methylpropanoate;isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-methylpropanoate;isoquinoline?
The IUPAC name of ethyl 2-methylpropanoate;isoquinoline (CID 158006464) is ethyl 2-methylpropanoate;isoquinoline.
What is the SMILES notation for ethyl 2-methylpropanoate;isoquinoline?
The canonical SMILES for ethyl 2-methylpropanoate;isoquinoline is CCOC(=O)C(C)C.c1ccc2cnccc2c1.
What is the InChIKey of ethyl 2-methylpropanoate;isoquinoline?
The InChIKey is FEISXLBOQOGLLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C6H12O2/c1-2-4-9-7-10-6-5-8(9)3-1;1-4-8-6(7)5(2)3/h1-7H;5H,4H2,1-3H3.
What are the key properties of ethyl 2-methylpropanoate;isoquinoline?
ethyl 2-methylpropanoate;isoquinoline has a molecular weight of 245.32 g/mol, XLogP of 3.44, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-methylpropanoate;isoquinoline is sourced from PubChem (CID 158006464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).