About ethane;isoquinoline;hydroiodide
ethane;isoquinoline;hydroiodide (PubChem CID 153349858) has the molecular formula C11H14IN
and a molecular weight of 287.14 g/mol. Its IUPAC name is ethane;isoquinoline;hydroiodide.
Molecular Properties
| Compound Name | ethane;isoquinoline;hydroiodide |
| PubChem CID | 153349858 |
| Molecular Formula | C11H14IN |
| Molecular Weight | 287.14 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | ethane;isoquinoline;hydroiodide |
| SMILES | CC.I.c1ccc2cnccc2c1 |
| InChI | InChI=1S/C9H7N.C2H6.HI/c1-2-4-9-7-10-6-5-8(9)3-1;1-2;/h1-7H;1-2H3;1H |
| InChIKey | XPXBKMUHQLOOJV-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.14 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze ethane;isoquinoline;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;isoquinoline;hydroiodide?
The IUPAC name of ethane;isoquinoline;hydroiodide (CID 153349858) is ethane;isoquinoline;hydroiodide.
What is the SMILES notation for ethane;isoquinoline;hydroiodide?
The canonical SMILES for ethane;isoquinoline;hydroiodide is CC.I.c1ccc2cnccc2c1.
What is the InChIKey of ethane;isoquinoline;hydroiodide?
The InChIKey is XPXBKMUHQLOOJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C2H6.HI/c1-2-4-9-7-10-6-5-8(9)3-1;1-2;/h1-7H;1-2H3;1H.
What are the key properties of ethane;isoquinoline;hydroiodide?
ethane;isoquinoline;hydroiodide has a molecular weight of 287.14 g/mol, XLogP of 3.88, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;isoquinoline;hydroiodide is sourced from PubChem (CID 153349858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).