About dichloroiron;isoquinoline
dichloroiron;isoquinoline (PubChem CID 157065360) has the molecular formula C9H7Cl2FeN
and a molecular weight of 255.91 g/mol. Its IUPAC name is dichloroiron;isoquinoline.
Molecular Properties
| Compound Name | dichloroiron;isoquinoline |
| PubChem CID | 157065360 |
| Molecular Formula | C9H7Cl2FeN |
| Molecular Weight | 255.91 g/mol |
| Exact Mass | 254.93 |
| IUPAC Name | dichloroiron;isoquinoline |
| SMILES | Cl[Fe]Cl.c1ccc2cnccc2c1 |
| InChI | InChI=1S/C9H7N.2ClH.Fe/c1-2-4-9-7-10-6-5-8(9)3-1;;;/h1-7H;2*1H;/q;;;+2/p-2 |
| InChIKey | ABUVHZWPXAJYLA-UHFFFAOYSA-L |
| XLogP | 3.61 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.91 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dichloroiron;isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloroiron;isoquinoline?
The IUPAC name of dichloroiron;isoquinoline (CID 157065360) is dichloroiron;isoquinoline.
What is the SMILES notation for dichloroiron;isoquinoline?
The canonical SMILES for dichloroiron;isoquinoline is Cl[Fe]Cl.c1ccc2cnccc2c1.
What is the InChIKey of dichloroiron;isoquinoline?
The InChIKey is ABUVHZWPXAJYLA-UHFFFAOYSA-L. The full InChI is InChI=1S/C9H7N.2ClH.Fe/c1-2-4-9-7-10-6-5-8(9)3-1;;;/h1-7H;2*1H;/q;;;+2/p-2.
What are the key properties of dichloroiron;isoquinoline?
dichloroiron;isoquinoline has a molecular weight of 255.91 g/mol, XLogP of 3.61, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dichloroiron;isoquinoline is sourced from PubChem (CID 157065360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).