About isoquinoline;1,3,5-triazine
isoquinoline;1,3,5-triazine (PubChem CID 175198893) has the molecular formula C12H10N4
and a molecular weight of 210.24 g/mol. Its IUPAC name is isoquinoline;1,3,5-triazine.
Molecular Properties
| Compound Name | isoquinoline;1,3,5-triazine |
| PubChem CID | 175198893 |
| Molecular Formula | C12H10N4 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | isoquinoline;1,3,5-triazine |
| SMILES | c1ccc2cnccc2c1.c1ncncn1 |
| InChI | InChI=1S/C9H7N.C3H3N3/c1-2-4-9-7-10-6-5-8(9)3-1;1-4-2-6-3-5-1/h1-7H;1-3H |
| InChIKey | ABERTUUQUOYVEU-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze isoquinoline;1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isoquinoline;1,3,5-triazine?
The IUPAC name of isoquinoline;1,3,5-triazine (CID 175198893) is isoquinoline;1,3,5-triazine.
What is the SMILES notation for isoquinoline;1,3,5-triazine?
The canonical SMILES for isoquinoline;1,3,5-triazine is c1ccc2cnccc2c1.c1ncncn1.
What is the InChIKey of isoquinoline;1,3,5-triazine?
The InChIKey is ABERTUUQUOYVEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C3H3N3/c1-2-4-9-7-10-6-5-8(9)3-1;1-4-2-6-3-5-1/h1-7H;1-3H.
What are the key properties of isoquinoline;1,3,5-triazine?
isoquinoline;1,3,5-triazine has a molecular weight of 210.24 g/mol, XLogP of 2.11, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for isoquinoline;1,3,5-triazine is sourced from PubChem (CID 175198893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).