About 1H-imidazole;isoquinoline
1H-imidazole;isoquinoline (PubChem CID 67481109) has the molecular formula C12H11N3
and a molecular weight of 197.24 g/mol. Its IUPAC name is 1H-imidazole;isoquinoline.
Molecular Properties
| Compound Name | 1H-imidazole;isoquinoline |
| PubChem CID | 67481109 |
| Molecular Formula | C12H11N3 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 1H-imidazole;isoquinoline |
| SMILES | c1c[nH]cn1.c1ccc2cnccc2c1 |
| InChI | InChI=1S/C9H7N.C3H4N2/c1-2-4-9-7-10-6-5-8(9)3-1;1-2-5-3-4-1/h1-7H;1-3H,(H,4,5) |
| InChIKey | PARWNYVQBTXHGG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-imidazole;isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-imidazole;isoquinoline?
The IUPAC name of 1H-imidazole;isoquinoline (CID 67481109) is 1H-imidazole;isoquinoline.
What is the SMILES notation for 1H-imidazole;isoquinoline?
The canonical SMILES for 1H-imidazole;isoquinoline is c1c[nH]cn1.c1ccc2cnccc2c1.
What is the InChIKey of 1H-imidazole;isoquinoline?
The InChIKey is PARWNYVQBTXHGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C3H4N2/c1-2-4-9-7-10-6-5-8(9)3-1;1-2-5-3-4-1/h1-7H;1-3H,(H,4,5).
What are the key properties of 1H-imidazole;isoquinoline?
1H-imidazole;isoquinoline has a molecular weight of 197.24 g/mol, XLogP of 2.64, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-imidazole;isoquinoline is sourced from PubChem (CID 67481109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).