About 1H-imidazole;2H-isoindole
1H-imidazole;2H-isoindole (PubChem CID 172782455) has the molecular formula C11H11N3
and a molecular weight of 185.23 g/mol. Its IUPAC name is 1H-imidazole;2H-isoindole.
Molecular Properties
| Compound Name | 1H-imidazole;2H-isoindole |
| PubChem CID | 172782455 |
| Molecular Formula | C11H11N3 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 1H-imidazole;2H-isoindole |
| SMILES | c1c[nH]cn1.c1ccc2c[nH]cc2c1 |
| InChI | InChI=1S/C8H7N.C3H4N2/c1-2-4-8-6-9-5-7(8)3-1;1-2-5-3-4-1/h1-6,9H;1-3H,(H,4,5) |
| InChIKey | OLBRPYZJDTWIML-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1H-imidazole;2H-isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-imidazole;2H-isoindole?
The IUPAC name of 1H-imidazole;2H-isoindole (CID 172782455) is 1H-imidazole;2H-isoindole.
What is the SMILES notation for 1H-imidazole;2H-isoindole?
The canonical SMILES for 1H-imidazole;2H-isoindole is c1c[nH]cn1.c1ccc2c[nH]cc2c1.
What is the InChIKey of 1H-imidazole;2H-isoindole?
The InChIKey is OLBRPYZJDTWIML-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N.C3H4N2/c1-2-4-8-6-9-5-7(8)3-1;1-2-5-3-4-1/h1-6,9H;1-3H,(H,4,5).
What are the key properties of 1H-imidazole;2H-isoindole?
1H-imidazole;2H-isoindole has a molecular weight of 185.23 g/mol, XLogP of 2.58, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-imidazole;2H-isoindole is sourced from PubChem (CID 172782455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).