C9H12N4 — CID 174792422
benzene-1,2-diamine;1H-imidazole (PubChem CID 174792422) has the molecular formula C9H12N4 and a molecular weight of 176.22 g/mol. Its IUPAC name is benzene-1,2-diamine;1H-imidazole.
| Compound Name | benzene-1,2-diamine;1H-imidazole |
|---|---|
| PubChem CID | 174792422 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | benzene-1,2-diamine;1H-imidazole |
| SMILES | Nc1ccccc1N.c1c[nH]cn1 |
| InChI | InChI=1S/C6H8N2.C3H4N2/c7-5-3-1-2-4-6(5)8;1-2-5-3-4-1/h1-4H,7-8H2;1-3H,(H,4,5) |
| InChIKey | VBVHDSZYVQPUDK-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 80.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|