About benzene-1,2-diamine;1H-imidazole
benzene-1,2-diamine;1H-imidazole (PubChem CID 174792422) has the molecular formula C9H12N4
and a molecular weight of 176.22 g/mol. Its IUPAC name is benzene-1,2-diamine;1H-imidazole.
Molecular Properties
| Compound Name | benzene-1,2-diamine;1H-imidazole |
| PubChem CID | 174792422 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | benzene-1,2-diamine;1H-imidazole |
| SMILES | Nc1ccccc1N.c1c[nH]cn1 |
| InChI | InChI=1S/C6H8N2.C3H4N2/c7-5-3-1-2-4-6(5)8;1-2-5-3-4-1/h1-4H,7-8H2;1-3H,(H,4,5) |
| InChIKey | VBVHDSZYVQPUDK-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 80.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,2-diamine;1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,2-diamine;1H-imidazole?
The IUPAC name of benzene-1,2-diamine;1H-imidazole (CID 174792422) is benzene-1,2-diamine;1H-imidazole.
What is the SMILES notation for benzene-1,2-diamine;1H-imidazole?
The canonical SMILES for benzene-1,2-diamine;1H-imidazole is Nc1ccccc1N.c1c[nH]cn1.
What is the InChIKey of benzene-1,2-diamine;1H-imidazole?
The InChIKey is VBVHDSZYVQPUDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2.C3H4N2/c7-5-3-1-2-4-6(5)8;1-2-5-3-4-1/h1-4H,7-8H2;1-3H,(H,4,5).
What are the key properties of benzene-1,2-diamine;1H-imidazole?
benzene-1,2-diamine;1H-imidazole has a molecular weight of 176.22 g/mol, XLogP of 1.26, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,2-diamine;1H-imidazole is sourced from PubChem (CID 174792422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).