C17H21N7 — CID 3237452
2-N-butyl-6-imidazol-1-yl-4-N-methyl-4-N-phenyl-1,3,5-triazine-2,4-diamine (PubChem CID 3237452) has the molecular formula C17H21N7 and a molecular weight of 323.40 g/mol. Its IUPAC name is 2-N-butyl-6-imidazol-1-yl-4-N-methyl-4-N-phenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-butyl-6-imidazol-1-yl-4-N-methyl-4-N-phenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 3237452 |
| Molecular Formula | C17H21N7 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | 2-N-butyl-6-imidazol-1-yl-4-N-methyl-4-N-phenyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCNc1nc(N(C)c2ccccc2)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C17H21N7/c1-3-4-10-19-15-20-16(23(2)14-8-6-5-7-9-14)22-17(21-15)24-12-11-18-13-24/h5-9,11-13H,3-4,10H2,1-2H3,(H,19,20,21,22) |
| InChIKey | KUGLEHGRXKMLME-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|