isoquinoline;propane-1-sulfonic acid

C12H15NO3S — CID 23498188

IUPACisoquinoline;propane-1-sulfonic acid
SMILESCCCS(=O)(=O)O.c1ccc2cnccc2c1
InChIInChI=1S/C9H7N.C3H8O3S/c1-2-4-9-7-10-6-5-8(9)3-1;1-2-3-7(4,5)6/h1-7H;2-3H2,1H3,(H,4,5,6)
InChIKeySNODKDNIVYEOJO-UHFFFAOYSA-N
MW253.32 g/mol
LogP2.52
Rot. Bonds2

About isoquinoline;propane-1-sulfonic acid

isoquinoline;propane-1-sulfonic acid (PubChem CID 23498188) has the molecular formula C12H15NO3S and a molecular weight of 253.32 g/mol. Its IUPAC name is isoquinoline;propane-1-sulfonic acid.

Molecular Properties

Compound Nameisoquinoline;propane-1-sulfonic acid
PubChem CID23498188
Molecular FormulaC12H15NO3S
Molecular Weight253.32 g/mol
Exact Mass253.08
IUPAC Nameisoquinoline;propane-1-sulfonic acid
SMILESCCCS(=O)(=O)O.c1ccc2cnccc2c1
InChIInChI=1S/C9H7N.C3H8O3S/c1-2-4-9-7-10-6-5-8(9)3-1;1-2-3-7(4,5)6/h1-7H;2-3H2,1H3,(H,4,5,6)
InChIKeySNODKDNIVYEOJO-UHFFFAOYSA-N
XLogP2.52
TPSA67.26 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500253.32
LogP ≤ 52.52
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze isoquinoline;propane-1-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of isoquinoline;propane-1-sulfonic acid?
The IUPAC name of isoquinoline;propane-1-sulfonic acid (CID 23498188) is isoquinoline;propane-1-sulfonic acid.
What is the SMILES notation for isoquinoline;propane-1-sulfonic acid?
The canonical SMILES for isoquinoline;propane-1-sulfonic acid is CCCS(=O)(=O)O.c1ccc2cnccc2c1.
What is the InChIKey of isoquinoline;propane-1-sulfonic acid?
The InChIKey is SNODKDNIVYEOJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C3H8O3S/c1-2-4-9-7-10-6-5-8(9)3-1;1-2-3-7(4,5)6/h1-7H;2-3H2,1H3,(H,4,5,6).
What are the key properties of isoquinoline;propane-1-sulfonic acid?
isoquinoline;propane-1-sulfonic acid has a molecular weight of 253.32 g/mol, XLogP of 2.52, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for isoquinoline;propane-1-sulfonic acid is sourced from PubChem (CID 23498188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).