About fluoromethanesulfonic acid;isoquinoline
fluoromethanesulfonic acid;isoquinoline (PubChem CID 161311899) has the molecular formula C10H10FNO3S
and a molecular weight of 243.26 g/mol. Its IUPAC name is fluoromethanesulfonic acid;isoquinoline.
Molecular Properties
| Compound Name | fluoromethanesulfonic acid;isoquinoline |
| PubChem CID | 161311899 |
| Molecular Formula | C10H10FNO3S |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | fluoromethanesulfonic acid;isoquinoline |
| SMILES | O=S(=O)(O)CF.c1ccc2cnccc2c1 |
| InChI | InChI=1S/C9H7N.CH3FO3S/c1-2-4-9-7-10-6-5-8(9)3-1;2-1-6(3,4)5/h1-7H;1H2,(H,3,4,5) |
| InChIKey | VIZQEAJCXLSCQE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze fluoromethanesulfonic acid;isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoromethanesulfonic acid;isoquinoline?
The IUPAC name of fluoromethanesulfonic acid;isoquinoline (CID 161311899) is fluoromethanesulfonic acid;isoquinoline.
What is the SMILES notation for fluoromethanesulfonic acid;isoquinoline?
The canonical SMILES for fluoromethanesulfonic acid;isoquinoline is O=S(=O)(O)CF.c1ccc2cnccc2c1.
What is the InChIKey of fluoromethanesulfonic acid;isoquinoline?
The InChIKey is VIZQEAJCXLSCQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.CH3FO3S/c1-2-4-9-7-10-6-5-8(9)3-1;2-1-6(3,4)5/h1-7H;1H2,(H,3,4,5).
What are the key properties of fluoromethanesulfonic acid;isoquinoline?
fluoromethanesulfonic acid;isoquinoline has a molecular weight of 243.26 g/mol, XLogP of 2.04, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for fluoromethanesulfonic acid;isoquinoline is sourced from PubChem (CID 161311899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).