About amino 2,2-dihydroxyacetate;isoquinoline;platinum
amino 2,2-dihydroxyacetate;isoquinoline;platinum (PubChem CID 87850656) has the molecular formula C11H12N2O4Pt
and a molecular weight of 431.31 g/mol. Its IUPAC name is amino 2,2-dihydroxyacetate;isoquinoline;platinum.
Molecular Properties
| Compound Name | amino 2,2-dihydroxyacetate;isoquinoline;platinum |
| PubChem CID | 87850656 |
| Molecular Formula | C11H12N2O4Pt |
| Molecular Weight | 431.31 g/mol |
| Exact Mass | 431.04 |
| IUPAC Name | amino 2,2-dihydroxyacetate;isoquinoline;platinum |
| SMILES | NOC(=O)C(O)O.[Pt].c1ccc2cnccc2c1 |
| InChI | InChI=1S/C9H7N.C2H5NO4.Pt/c1-2-4-9-7-10-6-5-8(9)3-1;3-7-2(6)1(4)5;/h1-7H;1,4-5H,3H2; |
| InChIKey | HXMXIBXXKGGDGK-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.31 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze amino 2,2-dihydroxyacetate;isoquinoline;platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino 2,2-dihydroxyacetate;isoquinoline;platinum?
The IUPAC name of amino 2,2-dihydroxyacetate;isoquinoline;platinum (CID 87850656) is amino 2,2-dihydroxyacetate;isoquinoline;platinum.
What is the SMILES notation for amino 2,2-dihydroxyacetate;isoquinoline;platinum?
The canonical SMILES for amino 2,2-dihydroxyacetate;isoquinoline;platinum is NOC(=O)C(O)O.[Pt].c1ccc2cnccc2c1.
What is the InChIKey of amino 2,2-dihydroxyacetate;isoquinoline;platinum?
The InChIKey is HXMXIBXXKGGDGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C2H5NO4.Pt/c1-2-4-9-7-10-6-5-8(9)3-1;3-7-2(6)1(4)5;/h1-7H;1,4-5H,3H2;.
What are the key properties of amino 2,2-dihydroxyacetate;isoquinoline;platinum?
amino 2,2-dihydroxyacetate;isoquinoline;platinum has a molecular weight of 431.31 g/mol, XLogP of -0.05, 1 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for amino 2,2-dihydroxyacetate;isoquinoline;platinum is sourced from PubChem (CID 87850656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).