C15H18N2O3 — CID 171883274
N-(3,4-dihydroxy-4-isoquinolin-8-ylbutyl)acetamide (PubChem CID 171883274) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is N-(3,4-dihydroxy-4-isoquinolin-8-ylbutyl)acetamide.
| Compound Name | N-(3,4-dihydroxy-4-isoquinolin-8-ylbutyl)acetamide |
|---|---|
| PubChem CID | 171883274 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | N-(3,4-dihydroxy-4-isoquinolin-8-ylbutyl)acetamide |
| SMILES | CC(=O)NCCC(O)C(O)c1cccc2ccncc12 |
| InChI | InChI=1S/C15H18N2O3/c1-10(18)17-8-6-14(19)15(20)12-4-2-3-11-5-7-16-9-13(11)12/h2-5,7,9,14-15,19-20H,6,8H2,1H3,(H,17,18) |
| InChIKey | IRHRAXJJRZMOAR-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |