C12H17NO5 — CID 171882639
N-[4-(2,6-dihydroxyphenyl)-3,4-dihydroxybutyl]acetamide (PubChem CID 171882639) has the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. Its IUPAC name is N-[4-(2,6-dihydroxyphenyl)-3,4-dihydroxybutyl]acetamide.
| Compound Name | N-[4-(2,6-dihydroxyphenyl)-3,4-dihydroxybutyl]acetamide |
|---|---|
| PubChem CID | 171882639 |
| Molecular Formula | C12H17NO5 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | N-[4-(2,6-dihydroxyphenyl)-3,4-dihydroxybutyl]acetamide |
| SMILES | CC(=O)NCCC(O)C(O)c1c(O)cccc1O |
| InChI | InChI=1S/C12H17NO5/c1-7(14)13-6-5-10(17)12(18)11-8(15)3-2-4-9(11)16/h2-4,10,12,15-18H,5-6H2,1H3,(H,13,14) |
| InChIKey | GYCMLTHGKKYWLH-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |