C12H16BrNO4 — CID 171884139
N-[4-(3-bromo-4-hydroxyphenyl)-3,4-dihydroxybutyl]acetamide (PubChem CID 171884139) has the molecular formula C12H16BrNO4 and a molecular weight of 318.17 g/mol. Its IUPAC name is N-[4-(3-bromo-4-hydroxyphenyl)-3,4-dihydroxybutyl]acetamide.
| Compound Name | N-[4-(3-bromo-4-hydroxyphenyl)-3,4-dihydroxybutyl]acetamide |
|---|---|
| PubChem CID | 171884139 |
| Molecular Formula | C12H16BrNO4 |
| Molecular Weight | 318.17 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | N-[4-(3-bromo-4-hydroxyphenyl)-3,4-dihydroxybutyl]acetamide |
| SMILES | CC(=O)NCCC(O)C(O)c1ccc(O)c(Br)c1 |
| InChI | InChI=1S/C12H16BrNO4/c1-7(15)14-5-4-11(17)12(18)8-2-3-10(16)9(13)6-8/h2-3,6,11-12,16-18H,4-5H2,1H3,(H,14,15) |
| InChIKey | CDIYYJMIJIREHG-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.17 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |