C12H17ClN2O3 — CID 171882761
N-[4-(3-amino-4-chlorophenyl)-3,4-dihydroxybutyl]acetamide (PubChem CID 171882761) has the molecular formula C12H17ClN2O3 and a molecular weight of 272.73 g/mol. Its IUPAC name is N-[4-(3-amino-4-chlorophenyl)-3,4-dihydroxybutyl]acetamide.
| Compound Name | N-[4-(3-amino-4-chlorophenyl)-3,4-dihydroxybutyl]acetamide |
|---|---|
| PubChem CID | 171882761 |
| Molecular Formula | C12H17ClN2O3 |
| Molecular Weight | 272.73 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | N-[4-(3-amino-4-chlorophenyl)-3,4-dihydroxybutyl]acetamide |
| SMILES | CC(=O)NCCC(O)C(O)c1ccc(Cl)c(N)c1 |
| InChI | InChI=1S/C12H17ClN2O3/c1-7(16)15-5-4-11(17)12(18)8-2-3-9(13)10(14)6-8/h2-3,6,11-12,17-18H,4-5,14H2,1H3,(H,15,16) |
| InChIKey | XRWYCOUBVZOARE-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.73 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|