C12H15Cl2NO3 — CID 171882625
N-[4-(3,5-dichlorophenyl)-3,4-dihydroxybutyl]acetamide (PubChem CID 171882625) has the molecular formula C12H15Cl2NO3 and a molecular weight of 292.16 g/mol. Its IUPAC name is N-[4-(3,5-dichlorophenyl)-3,4-dihydroxybutyl]acetamide.
| Compound Name | N-[4-(3,5-dichlorophenyl)-3,4-dihydroxybutyl]acetamide |
|---|---|
| PubChem CID | 171882625 |
| Molecular Formula | C12H15Cl2NO3 |
| Molecular Weight | 292.16 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | N-[4-(3,5-dichlorophenyl)-3,4-dihydroxybutyl]acetamide |
| SMILES | CC(=O)NCCC(O)C(O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H15Cl2NO3/c1-7(16)15-3-2-11(17)12(18)8-4-9(13)6-10(14)5-8/h4-6,11-12,17-18H,2-3H2,1H3,(H,15,16) |
| InChIKey | YSRGKYBFNHVIQU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.16 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |