C13H17F2NO3 — CID 171882893
N-[4-[3-(difluoromethyl)phenyl]-3,4-dihydroxybutyl]acetamide (PubChem CID 171882893) has the molecular formula C13H17F2NO3 and a molecular weight of 273.28 g/mol. Its IUPAC name is N-[4-[3-(difluoromethyl)phenyl]-3,4-dihydroxybutyl]acetamide.
| Compound Name | N-[4-[3-(difluoromethyl)phenyl]-3,4-dihydroxybutyl]acetamide |
|---|---|
| PubChem CID | 171882893 |
| Molecular Formula | C13H17F2NO3 |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | N-[4-[3-(difluoromethyl)phenyl]-3,4-dihydroxybutyl]acetamide |
| SMILES | CC(=O)NCCC(O)C(O)c1cccc(C(F)F)c1 |
| InChI | InChI=1S/C13H17F2NO3/c1-8(17)16-6-5-11(18)12(19)9-3-2-4-10(7-9)13(14)15/h2-4,7,11-13,18-19H,5-6H2,1H3,(H,16,17) |
| InChIKey | APYAYWVQGYWZKU-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |