C13H18ClNO3 — CID 171882590
N-[4-(3-chloro-4-methylphenyl)-3,4-dihydroxybutyl]acetamide (PubChem CID 171882590) has the molecular formula C13H18ClNO3 and a molecular weight of 271.74 g/mol. Its IUPAC name is N-[4-(3-chloro-4-methylphenyl)-3,4-dihydroxybutyl]acetamide.
| Compound Name | N-[4-(3-chloro-4-methylphenyl)-3,4-dihydroxybutyl]acetamide |
|---|---|
| PubChem CID | 171882590 |
| Molecular Formula | C13H18ClNO3 |
| Molecular Weight | 271.74 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | N-[4-(3-chloro-4-methylphenyl)-3,4-dihydroxybutyl]acetamide |
| SMILES | CC(=O)NCCC(O)C(O)c1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C13H18ClNO3/c1-8-3-4-10(7-11(8)14)13(18)12(17)5-6-15-9(2)16/h3-4,7,12-13,17-18H,5-6H2,1-2H3,(H,15,16) |
| InChIKey | KJJBEUMFMJCJMU-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.74 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |