C15H21NO4 — CID 171883380
N-[3,4-dihydroxy-4-(3-propanoylphenyl)butyl]acetamide (PubChem CID 171883380) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is N-[3,4-dihydroxy-4-(3-propanoylphenyl)butyl]acetamide.
| Compound Name | N-[3,4-dihydroxy-4-(3-propanoylphenyl)butyl]acetamide |
|---|---|
| PubChem CID | 171883380 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | N-[3,4-dihydroxy-4-(3-propanoylphenyl)butyl]acetamide |
| SMILES | CCC(=O)c1cccc(C(O)C(O)CCNC(C)=O)c1 |
| InChI | InChI=1S/C15H21NO4/c1-3-13(18)11-5-4-6-12(9-11)15(20)14(19)7-8-16-10(2)17/h4-6,9,14-15,19-20H,3,7-8H2,1-2H3,(H,16,17) |
| InChIKey | WPZIKDXULZHIQZ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |