C13H16N2O3 — CID 171882773
N-[4-(3-cyanophenyl)-3,4-dihydroxybutyl]acetamide (PubChem CID 171882773) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is N-[4-(3-cyanophenyl)-3,4-dihydroxybutyl]acetamide.
| Compound Name | N-[4-(3-cyanophenyl)-3,4-dihydroxybutyl]acetamide |
|---|---|
| PubChem CID | 171882773 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | N-[4-(3-cyanophenyl)-3,4-dihydroxybutyl]acetamide |
| SMILES | CC(=O)NCCC(O)C(O)c1cccc(C#N)c1 |
| InChI | InChI=1S/C13H16N2O3/c1-9(16)15-6-5-12(17)13(18)11-4-2-3-10(7-11)8-14/h2-4,7,12-13,17-18H,5-6H2,1H3,(H,15,16) |
| InChIKey | SXVWHUITLCFSEV-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |