C13H18O3S — CID 171874423
1-[3-(1,2-dihydroxy-4-sulfanylbutyl)phenyl]propan-1-one (PubChem CID 171874423) has the molecular formula C13H18O3S and a molecular weight of 254.35 g/mol. Its IUPAC name is 1-[3-(1,2-dihydroxy-4-sulfanylbutyl)phenyl]propan-1-one.
| Compound Name | 1-[3-(1,2-dihydroxy-4-sulfanylbutyl)phenyl]propan-1-one |
|---|---|
| PubChem CID | 171874423 |
| Molecular Formula | C13H18O3S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 1-[3-(1,2-dihydroxy-4-sulfanylbutyl)phenyl]propan-1-one |
| SMILES | CCC(=O)c1cccc(C(O)C(O)CCS)c1 |
| InChI | InChI=1S/C13H18O3S/c1-2-11(14)9-4-3-5-10(8-9)13(16)12(15)6-7-17/h3-5,8,12-13,15-17H,2,6-7H2,1H3 |
| InChIKey | XYGWNVARWQFGIR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|