C13H19NO4 — CID 171872999
N,N-dimethyl-3-(1,2,4-trihydroxybutyl)benzamide (PubChem CID 171872999) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is N,N-dimethyl-3-(1,2,4-trihydroxybutyl)benzamide.
| Compound Name | N,N-dimethyl-3-(1,2,4-trihydroxybutyl)benzamide |
|---|---|
| PubChem CID | 171872999 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | N,N-dimethyl-3-(1,2,4-trihydroxybutyl)benzamide |
| SMILES | CN(C)C(=O)c1cccc(C(O)C(O)CCO)c1 |
| InChI | InChI=1S/C13H19NO4/c1-14(2)13(18)10-5-3-4-9(8-10)12(17)11(16)6-7-15/h3-5,8,11-12,15-17H,6-7H2,1-2H3 |
| InChIKey | FHURGVPKYANKEW-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |