C11H15NO4 — CID 171872426
3-(1,2,4-trihydroxybutyl)benzamide (PubChem CID 171872426) has the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. Its IUPAC name is 3-(1,2,4-trihydroxybutyl)benzamide.
| Compound Name | 3-(1,2,4-trihydroxybutyl)benzamide |
|---|---|
| PubChem CID | 171872426 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 3-(1,2,4-trihydroxybutyl)benzamide |
| SMILES | NC(=O)c1cccc(C(O)C(O)CCO)c1 |
| InChI | InChI=1S/C11H15NO4/c12-11(16)8-3-1-2-7(6-8)10(15)9(14)4-5-13/h1-3,6,9-10,13-15H,4-5H2,(H2,12,16) |
| InChIKey | IYSPIMOZCNHEAL-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |