C13H15NO3S — CID 171874793
3-[3-(1,2-dihydroxy-4-sulfanylbutyl)phenyl]-3-oxopropanenitrile (PubChem CID 171874793) has the molecular formula C13H15NO3S and a molecular weight of 265.33 g/mol. Its IUPAC name is 3-[3-(1,2-dihydroxy-4-sulfanylbutyl)phenyl]-3-oxopropanenitrile.
| Compound Name | 3-[3-(1,2-dihydroxy-4-sulfanylbutyl)phenyl]-3-oxopropanenitrile |
|---|---|
| PubChem CID | 171874793 |
| Molecular Formula | C13H15NO3S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | 3-[3-(1,2-dihydroxy-4-sulfanylbutyl)phenyl]-3-oxopropanenitrile |
| SMILES | N#CCC(=O)c1cccc(C(O)C(O)CCS)c1 |
| InChI | InChI=1S/C13H15NO3S/c14-6-4-11(15)9-2-1-3-10(8-9)13(17)12(16)5-7-18/h1-3,8,12-13,16-18H,4-5,7H2 |
| InChIKey | PLYOASALGKJBLO-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|