C11H17NO2S — CID 171873821
1-[3-(aminomethyl)phenyl]-4-sulfanylbutane-1,2-diol (PubChem CID 171873821) has the molecular formula C11H17NO2S and a molecular weight of 227.33 g/mol. Its IUPAC name is 1-[3-(aminomethyl)phenyl]-4-sulfanylbutane-1,2-diol.
| Compound Name | 1-[3-(aminomethyl)phenyl]-4-sulfanylbutane-1,2-diol |
|---|---|
| PubChem CID | 171873821 |
| Molecular Formula | C11H17NO2S |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 1-[3-(aminomethyl)phenyl]-4-sulfanylbutane-1,2-diol |
| SMILES | NCc1cccc(C(O)C(O)CCS)c1 |
| InChI | InChI=1S/C11H17NO2S/c12-7-8-2-1-3-9(6-8)11(14)10(13)4-5-15/h1-3,6,10-11,13-15H,4-5,7,12H2 |
| InChIKey | HEVXCGCSXAGLTH-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|