C10H14O3S — CID 170817395
1-[3-(sulfanylmethyl)phenyl]propane-1,2,3-triol (PubChem CID 170817395) has the molecular formula C10H14O3S and a molecular weight of 214.29 g/mol. Its IUPAC name is 1-[3-(sulfanylmethyl)phenyl]propane-1,2,3-triol.
| Compound Name | 1-[3-(sulfanylmethyl)phenyl]propane-1,2,3-triol |
|---|---|
| PubChem CID | 170817395 |
| Molecular Formula | C10H14O3S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 1-[3-(sulfanylmethyl)phenyl]propane-1,2,3-triol |
| SMILES | OCC(O)C(O)c1cccc(CS)c1 |
| InChI | InChI=1S/C10H14O3S/c11-5-9(12)10(13)8-3-1-2-7(4-8)6-14/h1-4,9-14H,5-6H2 |
| InChIKey | KAYLLZKHMQKQAZ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|