C9H11F5O3S — CID 170819101
1-[3-(pentafluoro-λ6-sulfanyl)phenyl]propane-1,2,3-triol (PubChem CID 170819101) has the molecular formula C9H11F5O3S and a molecular weight of 294.24 g/mol. Its IUPAC name is 1-[3-(pentafluoro-λ6-sulfanyl)phenyl]propane-1,2,3-triol.
| Compound Name | 1-[3-(pentafluoro-λ6-sulfanyl)phenyl]propane-1,2,3-triol |
|---|---|
| PubChem CID | 170819101 |
| Molecular Formula | C9H11F5O3S |
| Molecular Weight | 294.24 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 1-[3-(pentafluoro-λ6-sulfanyl)phenyl]propane-1,2,3-triol |
| SMILES | OCC(O)C(O)c1cccc(S(F)(F)(F)(F)F)c1 |
| InChI | InChI=1S/C9H11F5O3S/c10-18(11,12,13,14)7-3-1-2-6(4-7)9(17)8(16)5-15/h1-4,8-9,15-17H,5H2 |
| InChIKey | FVYUYEXBHQCIKL-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.24 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |