C10H11FO4 — CID 170817775
2-fluoro-4-(1,2,3-trihydroxypropyl)benzaldehyde (PubChem CID 170817775) has the molecular formula C10H11FO4 and a molecular weight of 214.19 g/mol. Its IUPAC name is 2-fluoro-4-(1,2,3-trihydroxypropyl)benzaldehyde.
| Compound Name | 2-fluoro-4-(1,2,3-trihydroxypropyl)benzaldehyde |
|---|---|
| PubChem CID | 170817775 |
| Molecular Formula | C10H11FO4 |
| Molecular Weight | 214.19 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 2-fluoro-4-(1,2,3-trihydroxypropyl)benzaldehyde |
| SMILES | O=Cc1ccc(C(O)C(O)CO)cc1F |
| InChI | InChI=1S/C10H11FO4/c11-8-3-6(1-2-7(8)4-12)10(15)9(14)5-13/h1-4,9-10,13-15H,5H2 |
| InChIKey | CSVOWWCITUSRHC-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.19 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|