C10H10F4O3 — CID 170818370
1-[3-fluoro-4-(trifluoromethyl)phenyl]propane-1,2,3-triol (PubChem CID 170818370) has the molecular formula C10H10F4O3 and a molecular weight of 254.18 g/mol. Its IUPAC name is 1-[3-fluoro-4-(trifluoromethyl)phenyl]propane-1,2,3-triol.
| Compound Name | 1-[3-fluoro-4-(trifluoromethyl)phenyl]propane-1,2,3-triol |
|---|---|
| PubChem CID | 170818370 |
| Molecular Formula | C10H10F4O3 |
| Molecular Weight | 254.18 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 1-[3-fluoro-4-(trifluoromethyl)phenyl]propane-1,2,3-triol |
| SMILES | OCC(O)C(O)c1ccc(C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C10H10F4O3/c11-7-3-5(9(17)8(16)4-15)1-2-6(7)10(12,13)14/h1-3,8-9,15-17H,4H2 |
| InChIKey | JGUKWMLFJZJXNZ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.18 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |