C13H14F4O2 — CID 107288626
2-cyclopropyl-1-[3-fluoro-4-(trifluoromethyl)phenyl]-2-methoxyethanol (PubChem CID 107288626) has the molecular formula C13H14F4O2 and a molecular weight of 278.25 g/mol. Its IUPAC name is 2-cyclopropyl-1-[3-fluoro-4-(trifluoromethyl)phenyl]-2-methoxyethanol.
| Compound Name | 2-cyclopropyl-1-[3-fluoro-4-(trifluoromethyl)phenyl]-2-methoxyethanol |
|---|---|
| PubChem CID | 107288626 |
| Molecular Formula | C13H14F4O2 |
| Molecular Weight | 278.25 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 2-cyclopropyl-1-[3-fluoro-4-(trifluoromethyl)phenyl]-2-methoxyethanol |
| SMILES | COC(C1CC1)C(O)c1ccc(C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C13H14F4O2/c1-19-12(7-2-3-7)11(18)8-4-5-9(10(14)6-8)13(15,16)17/h4-7,11-12,18H,2-3H2,1H3 |
| InChIKey | RVCWRQMZGJLKMA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.25 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |