C14H16F4O3 — CID 107288648
[3-fluoro-4-(trifluoromethyl)phenyl]-(4-methoxyoxan-4-yl)methanol (PubChem CID 107288648) has the molecular formula C14H16F4O3 and a molecular weight of 308.27 g/mol. Its IUPAC name is [3-fluoro-4-(trifluoromethyl)phenyl]-(4-methoxyoxan-4-yl)methanol.
| Compound Name | [3-fluoro-4-(trifluoromethyl)phenyl]-(4-methoxyoxan-4-yl)methanol |
|---|---|
| PubChem CID | 107288648 |
| Molecular Formula | C14H16F4O3 |
| Molecular Weight | 308.27 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | [3-fluoro-4-(trifluoromethyl)phenyl]-(4-methoxyoxan-4-yl)methanol |
| SMILES | COC1(C(O)c2ccc(C(F)(F)F)c(F)c2)CCOCC1 |
| InChI | InChI=1S/C14H16F4O3/c1-20-13(4-6-21-7-5-13)12(19)9-2-3-10(11(15)8-9)14(16,17)18/h2-3,8,12,19H,4-7H2,1H3 |
| InChIKey | RLLJGIQOAHNEKW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.27 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |