C15H19F3O3 — CID 116754328
(4-ethoxyoxan-4-yl)-[3-(trifluoromethyl)phenyl]methanol (PubChem CID 116754328) has the molecular formula C15H19F3O3 and a molecular weight of 304.31 g/mol. Its IUPAC name is (4-ethoxyoxan-4-yl)-[3-(trifluoromethyl)phenyl]methanol.
| Compound Name | (4-ethoxyoxan-4-yl)-[3-(trifluoromethyl)phenyl]methanol |
|---|---|
| PubChem CID | 116754328 |
| Molecular Formula | C15H19F3O3 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | (4-ethoxyoxan-4-yl)-[3-(trifluoromethyl)phenyl]methanol |
| SMILES | CCOC1(C(O)c2cccc(C(F)(F)F)c2)CCOCC1 |
| InChI | InChI=1S/C15H19F3O3/c1-2-21-14(6-8-20-9-7-14)13(19)11-4-3-5-12(10-11)15(16,17)18/h3-5,10,13,19H,2,6-9H2,1H3 |
| InChIKey | PKQWMARFUDBYIH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |