C15H21F3O — CID 115792392
2-propyl-1-[3-(trifluoromethyl)phenyl]pentan-1-ol (PubChem CID 115792392) has the molecular formula C15H21F3O and a molecular weight of 274.33 g/mol. Its IUPAC name is 2-propyl-1-[3-(trifluoromethyl)phenyl]pentan-1-ol.
| Compound Name | 2-propyl-1-[3-(trifluoromethyl)phenyl]pentan-1-ol |
|---|---|
| PubChem CID | 115792392 |
| Molecular Formula | C15H21F3O |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 2-propyl-1-[3-(trifluoromethyl)phenyl]pentan-1-ol |
| SMILES | CCCC(CCC)C(O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H21F3O/c1-3-6-11(7-4-2)14(19)12-8-5-9-13(10-12)15(16,17)18/h5,8-11,14,19H,3-4,6-7H2,1-2H3 |
| InChIKey | KIXJBKJAGJJVOL-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |