C13H19ClF3N — CID 171206800
(1R)-1-[3-(trifluoromethyl)phenyl]hexan-1-amine;hydrochloride (PubChem CID 171206800) has the molecular formula C13H19ClF3N and a molecular weight of 281.75 g/mol. Its IUPAC name is (1R)-1-[3-(trifluoromethyl)phenyl]hexan-1-amine;hydrochloride.
| Compound Name | (1R)-1-[3-(trifluoromethyl)phenyl]hexan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171206800 |
| Molecular Formula | C13H19ClF3N |
| Molecular Weight | 281.75 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | (1R)-1-[3-(trifluoromethyl)phenyl]hexan-1-amine;hydrochloride |
| SMILES | CCCCC[C@@H](N)c1cccc(C(F)(F)F)c1.Cl |
| InChI | InChI=1S/C13H18F3N.ClH/c1-2-3-4-8-12(17)10-6-5-7-11(9-10)13(14,15)16;/h5-7,9,12H,2-4,8,17H2,1H3;1H/t12-;/m1./s1 |
| InChIKey | QHIJPHLBWUUING-UTONKHPSSA-N |
| XLogP | 4.71 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.75 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|