C13H21Cl2F3N2 — CID 70300182
1-N'-[3-(trifluoromethyl)phenyl]hexane-1,1-diamine;dihydrochloride (PubChem CID 70300182) has the molecular formula C13H21Cl2F3N2 and a molecular weight of 333.23 g/mol. Its IUPAC name is 1-N'-[3-(trifluoromethyl)phenyl]hexane-1,1-diamine;dihydrochloride.
| Compound Name | 1-N'-[3-(trifluoromethyl)phenyl]hexane-1,1-diamine;dihydrochloride |
|---|---|
| PubChem CID | 70300182 |
| Molecular Formula | C13H21Cl2F3N2 |
| Molecular Weight | 333.23 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 1-N'-[3-(trifluoromethyl)phenyl]hexane-1,1-diamine;dihydrochloride |
| SMILES | CCCCCC(N)Nc1cccc(C(F)(F)F)c1.Cl.Cl |
| InChI | InChI=1S/C13H19F3N2.2ClH/c1-2-3-4-8-12(17)18-11-7-5-6-10(9-11)13(14,15)16;;/h5-7,9,12,18H,2-4,8,17H2,1H3;2*1H |
| InChIKey | KGODWOVXCKCWBU-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.23 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|