C15H22F3N3O — CID 68650829
(2S)-6-amino-N,N-dimethyl-2-[3-(trifluoromethyl)anilino]hexanamide (PubChem CID 68650829) has the molecular formula C15H22F3N3O and a molecular weight of 317.36 g/mol. Its IUPAC name is (2S)-6-amino-N,N-dimethyl-2-[3-(trifluoromethyl)anilino]hexanamide.
| Compound Name | (2S)-6-amino-N,N-dimethyl-2-[3-(trifluoromethyl)anilino]hexanamide |
|---|---|
| PubChem CID | 68650829 |
| Molecular Formula | C15H22F3N3O |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | (2S)-6-amino-N,N-dimethyl-2-[3-(trifluoromethyl)anilino]hexanamide |
| SMILES | CN(C)C(=O)[C@H](CCCCN)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H22F3N3O/c1-21(2)14(22)13(8-3-4-9-19)20-12-7-5-6-11(10-12)15(16,17)18/h5-7,10,13,20H,3-4,8-9,19H2,1-2H3/t13-/m0/s1 |
| InChIKey | ZUDNWNHSHKBOAX-ZDUSSCGKSA-N |
| XLogP | 2.70 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|