C20H24F3N7O2 — CID 66859667
(2R)-6-amino-N-(2-amino-5-cyano-6-ethoxypyrimidin-4-yl)-2-[3-(trifluoromethyl)anilino]hexanamide (PubChem CID 66859667) has the molecular formula C20H24F3N7O2 and a molecular weight of 451.45 g/mol. Its IUPAC name is (2R)-6-amino-N-(2-amino-5-cyano-6-ethoxypyrimidin-4-yl)-2-[3-(trifluoromethyl)anilino]hexanamide.
| Compound Name | (2R)-6-amino-N-(2-amino-5-cyano-6-ethoxypyrimidin-4-yl)-2-[3-(trifluoromethyl)anilino]hexanamide |
|---|---|
| PubChem CID | 66859667 |
| Molecular Formula | C20H24F3N7O2 |
| Molecular Weight | 451.45 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | (2R)-6-amino-N-(2-amino-5-cyano-6-ethoxypyrimidin-4-yl)-2-[3-(trifluoromethyl)anilino]hexanamide |
| SMILES | CCOc1nc(N)nc(NC(=O)[C@@H](CCCCN)Nc2cccc(C(F)(F)F)c2)c1C#N |
| InChI | InChI=1S/C20H24F3N7O2/c1-2-32-18-14(11-25)16(29-19(26)30-18)28-17(31)15(8-3-4-9-24)27-13-7-5-6-12(10-13)20(21,22)23/h5-7,10,15,27H,2-4,8-9,24H2,1H3,(H3,26,28,29,30,31)/t15-/m1/s1 |
| InChIKey | JMZUWABGVYGTAT-OAHLLOKOSA-N |
| XLogP | 2.90 |
| TPSA | 151.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.45 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|