C20H23F3N8O3 — CID 91562176
(2S)-2-[N-(2-amino-5-cyano-6-ethoxypyrimidin-4-yl)-3-(trifluoromethyl)anilino]-5-(carbamoylamino)pentanamide (PubChem CID 91562176) has the molecular formula C20H23F3N8O3 and a molecular weight of 480.45 g/mol. Its IUPAC name is (2S)-2-[N-(2-amino-5-cyano-6-ethoxypyrimidin-4-yl)-3-(trifluoromethyl)anilino]-5-(carbamoylamino)pentanamide.
| Compound Name | (2S)-2-[N-(2-amino-5-cyano-6-ethoxypyrimidin-4-yl)-3-(trifluoromethyl)anilino]-5-(carbamoylamino)pentanamide |
|---|---|
| PubChem CID | 91562176 |
| Molecular Formula | C20H23F3N8O3 |
| Molecular Weight | 480.45 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | (2S)-2-[N-(2-amino-5-cyano-6-ethoxypyrimidin-4-yl)-3-(trifluoromethyl)anilino]-5-(carbamoylamino)pentanamide |
| SMILES | CCOc1nc(N)nc(N(c2cccc(C(F)(F)F)c2)[C@@H](CCCNC(N)=O)C(N)=O)c1C#N |
| InChI | InChI=1S/C20H23F3N8O3/c1-2-34-17-13(10-24)16(29-18(26)30-17)31(12-6-3-5-11(9-12)20(21,22)23)14(15(25)32)7-4-8-28-19(27)33/h3,5-6,9,14H,2,4,7-8H2,1H3,(H2,25,32)(H2,26,29,30)(H3,27,28,33)/t14-/m0/s1 |
| InChIKey | URQUELBJIFFWNM-AWEZNQCLSA-N |
| XLogP | 1.79 |
| TPSA | 186.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.45 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|