C20H22F3N7O2S — CID 68650656
(2S)-5-acetamido-2-[N-(2-amino-5-cyano-6-methylsulfanylpyrimidin-4-yl)-3-(trifluoromethyl)anilino]pentanamide (PubChem CID 68650656) has the molecular formula C20H22F3N7O2S and a molecular weight of 481.50 g/mol. Its IUPAC name is (2S)-5-acetamido-2-[N-(2-amino-5-cyano-6-methylsulfanylpyrimidin-4-yl)-3-(trifluoromethyl)anilino]pentanamide.
| Compound Name | (2S)-5-acetamido-2-[N-(2-amino-5-cyano-6-methylsulfanylpyrimidin-4-yl)-3-(trifluoromethyl)anilino]pentanamide |
|---|---|
| PubChem CID | 68650656 |
| Molecular Formula | C20H22F3N7O2S |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | (2S)-5-acetamido-2-[N-(2-amino-5-cyano-6-methylsulfanylpyrimidin-4-yl)-3-(trifluoromethyl)anilino]pentanamide |
| SMILES | CSc1nc(N)nc(N(c2cccc(C(F)(F)F)c2)[C@@H](CCCNC(C)=O)C(N)=O)c1C#N |
| InChI | InChI=1S/C20H22F3N7O2S/c1-11(31)27-8-4-7-15(16(25)32)30(13-6-3-5-12(9-13)20(21,22)23)17-14(10-24)18(33-2)29-19(26)28-17/h3,5-6,9,15H,4,7-8H2,1-2H3,(H2,25,32)(H,27,31)(H2,26,28,29)/t15-/m0/s1 |
| InChIKey | JZFLOVBQWYKLCM-HNNXBMFYSA-N |
| XLogP | 2.58 |
| TPSA | 151.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|