C19H22F3N7OS — CID 66861211
(2S)-2,6-diamino-2-(2-amino-5-cyano-6-methylsulfanylpyrimidin-4-yl)-N-[3-(trifluoromethyl)phenyl]hexanamide (PubChem CID 66861211) has the molecular formula C19H22F3N7OS and a molecular weight of 453.49 g/mol. Its IUPAC name is (2S)-2,6-diamino-2-(2-amino-5-cyano-6-methylsulfanylpyrimidin-4-yl)-N-[3-(trifluoromethyl)phenyl]hexanamide.
| Compound Name | (2S)-2,6-diamino-2-(2-amino-5-cyano-6-methylsulfanylpyrimidin-4-yl)-N-[3-(trifluoromethyl)phenyl]hexanamide |
|---|---|
| PubChem CID | 66861211 |
| Molecular Formula | C19H22F3N7OS |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | (2S)-2,6-diamino-2-(2-amino-5-cyano-6-methylsulfanylpyrimidin-4-yl)-N-[3-(trifluoromethyl)phenyl]hexanamide |
| SMILES | CSc1nc(N)nc([C@@](N)(CCCCN)C(=O)Nc2cccc(C(F)(F)F)c2)c1C#N |
| InChI | InChI=1S/C19H22F3N7OS/c1-31-15-13(10-24)14(28-17(25)29-15)18(26,7-2-3-8-23)16(30)27-12-6-4-5-11(9-12)19(20,21)22/h4-6,9H,2-3,7-8,23,26H2,1H3,(H,27,30)(H2,25,28,29)/t18-/m0/s1 |
| InChIKey | WPFXYBZPSDGMQE-SFHVURJKSA-N |
| XLogP | 2.59 |
| TPSA | 156.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|